| 
|  | YK-4-279Description of:YK-4-279YK-4-279(cas:1037184-44-3)is a ETV1 inhibitor, which inhibitor protein-protein interactions between ES-FLI1 and RHA.YK-...
 More>> |  | 
| 
|  | COH29Description of:COH29(cas:1190932-38-7)COH29 is a potent ribonucleotide reductase (RNR) inhibitor with anticancer activity with an IC50 of 8 &m...
 More>> |  | 
| 
|  | TMP195Description of:TMP195(cas:1314891-22-9)TMP195 is a potent and selective class IIa HDAC inhibitor with IC50s of 59 nM, 60 nM, 26 nM and 15 nM f...
 More>> |  | 
| 
|  | TMP269Chemical Information
    
        
            M.Wt
            514.52
            Storage
            Please store the product under ...More>> |  | 
| 
|  | Nexturastat AChemical Information
    
        
            M.Wt
            341.4
            Storage
            Please store the product under t...More>> |  | 
|  | 
|  | 
| 
|  | ValrubicinWith a mechanism of action that appears to differ from doxorubicin, valrubicin is converted intracytoplasmically into N-trifluoroacetyladriamycin, whi...More>> |  | 
| 
|  | Ixabepilone (BMS -247550)Ixabepilone (BMS-247550) is an orally bioavailable semisynthetic analogue of epothilone B with antineoplastic activity. Ixabepilone binds to tubulin a...More>> |  | 
| 
|  | PirarubicinPirarubicin is an anthracycline agent. Pirarubicin intercalates into DNA and interacts with topoisomerase II, thereby inhibiting DNA replication and r...More>> |  | 
| 
|  | EPZ 5676EPZ-5676 is an S-adenosyl methionine (SAM) competitive inhibitor of DOT11L with Ki of 80 pM. -EPZ-5676 is a small molecule inhibitor of histone methyl...More>> |  | 
|  | 
| 
|  | AmrubicinAmrubicin intercalates into DNA and inhibits the activity of topoisomerase II, resulting in inhibition of DNA replication, and RNA and protein synthes...More>> |  | 
| 
|  | M 344M344 is a potent HDAC inhibitor with IC50 of 100 nM. M344 induces terminal cell differentiation and causes an increase in hyperacetylated histone H4. ...More>> |  | 
| 
|  | Tacedinaline (CI 994, PD 123654)CI994 (Tacedinaline) is an anti-cancer drug which inhibits HDAC1 with IC50 of 0.57 μM. Tacedinaline inhibits histone deacetylation, which may resul...More>> |  | 
| 
|  | Daunorubicin (Daunomycin)Daunorubicin HCl (Daunomycin) inhibits both DNA and RNA synthesis and inhibits DNA synthesis with Ki of 0.02 μM. Daunorubicin is a DNA intercalatin...More>> |  |